weezer010902 weezer010902

03-11-2019
Chemistry

contestada

How many moles of oxygen are required to produce 4 moles of water?

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn maizetycorn

03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles H2O

Answer Link

soniaaguirre01234 soniaaguirre01234

03-11-2019

6. How do I know? Just took the test boyy

Answer Link

Otras preguntas

For each of the given elements, list two other elements that have similar chemical properties. A. iodine B. barium C. iron

The sum of the squares of two consecutive even integers is 452. find the two integers.

Motels were built after world war ii because of the

Two cards are drawn at random from a standard deck of 52 cards. what is the probability that both cards are aces

Please help me on all of these please and thank you I’m putting all my points for it please

I need 20 strings of 3/8inches each. If I have a string 4 and 7/8inches how much more do I need?

How many chiral carbon atoms does the monosaccharide galactose have?

In terms of gender differences in intellectual abilities, females tend to:

If you're in a car accident caused by someone else who also has insurance, which type of insurance plan will not require you to pay out of pocket costs? a.) Hi

Why is a changing ocean temperature of only one or 2 degrees so concerning?